C17H27NO2 — CID 71285671
2,5-dimethyl-3-[2-methyl-4-[methyl(propyl)amino]butan-2-yl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 71285671) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is 2,5-dimethyl-3-[2-methyl-4-[methyl(propyl)amino]butan-2-yl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-dimethyl-3-[2-methyl-4-[methyl(propyl)amino]butan-2-yl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 71285671 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 2,5-dimethyl-3-[2-methyl-4-[methyl(propyl)amino]butan-2-yl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CCCN(C)CCC(C)(C)C1=C(C)C(=O)C=C(C)C1=O |
| InChI | InChI=1S/C17H27NO2/c1-7-9-18(6)10-8-17(4,5)15-13(3)14(19)11-12(2)16(15)20/h11H,7-10H2,1-6H3 |
| InChIKey | FOQKIXFGQOAOCI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|