C30H46N6O3Si2 — CID 71285682
N-butyl-5-(2-trimethylsilylethoxymethyl)-2-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridin-7-yl]pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 71285682) has the molecular formula C30H46N6O3Si2 and a molecular weight of 594.91 g/mol. Its IUPAC name is N-butyl-5-(2-trimethylsilylethoxymethyl)-2-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridin-7-yl]pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | N-butyl-5-(2-trimethylsilylethoxymethyl)-2-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridin-7-yl]pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 71285682 |
| Molecular Formula | C30H46N6O3Si2 |
| Molecular Weight | 594.91 g/mol |
| Exact Mass | 594.32 |
| IUPAC Name | N-butyl-5-(2-trimethylsilylethoxymethyl)-2-[1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridin-7-yl]pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | CCCCNC(=O)c1cn(COCC[Si](C)(C)C)c2ncc(-c3nccc4ccn(COCC[Si](C)(C)C)c34)nc12 |
| InChI | InChI=1S/C30H46N6O3Si2/c1-8-9-12-32-30(37)24-20-36(22-39-16-18-41(5,6)7)29-26(24)34-25(19-33-29)27-28-23(10-13-31-27)11-14-35(28)21-38-15-17-40(2,3)4/h10-11,13-14,19-20H,8-9,12,15-18,21-22H2,1-7H3,(H,32,37) |
| InChIKey | QFZMXFHLRAYNSR-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.91 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|