C26H30FN7O3Si — CID 71285979
2-(6-fluoro-1-methylindazol-3-yl)-N-[1-(1,2-oxazol-3-yl)ethyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 71285979) has the molecular formula C26H30FN7O3Si and a molecular weight of 535.66 g/mol. Its IUPAC name is 2-(6-fluoro-1-methylindazol-3-yl)-N-[1-(1,2-oxazol-3-yl)ethyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | 2-(6-fluoro-1-methylindazol-3-yl)-N-[1-(1,2-oxazol-3-yl)ethyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 71285979 |
| Molecular Formula | C26H30FN7O3Si |
| Molecular Weight | 535.66 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | 2-(6-fluoro-1-methylindazol-3-yl)-N-[1-(1,2-oxazol-3-yl)ethyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | CC(NC(=O)c1cn(COCC[Si](C)(C)C)c2ncc(-c3nn(C)c4cc(F)ccc34)nc12)c1ccon1 |
| InChI | InChI=1S/C26H30FN7O3Si/c1-16(20-8-9-37-32-20)29-26(35)19-14-34(15-36-10-11-38(3,4)5)25-24(19)30-21(13-28-25)23-18-7-6-17(27)12-22(18)33(2)31-23/h6-9,12-14,16H,10-11,15H2,1-5H3,(H,29,35) |
| InChIKey | PAOBVYCIDCHUFQ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 112.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.66 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|