C25H33ClN6O3Si — CID 71286068
2-(6-chloro-1-methylindazol-3-yl)-N-[(2S)-1-methoxypropan-2-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 71286068) has the molecular formula C25H33ClN6O3Si and a molecular weight of 529.12 g/mol. Its IUPAC name is 2-(6-chloro-1-methylindazol-3-yl)-N-[(2S)-1-methoxypropan-2-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | 2-(6-chloro-1-methylindazol-3-yl)-N-[(2S)-1-methoxypropan-2-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 71286068 |
| Molecular Formula | C25H33ClN6O3Si |
| Molecular Weight | 529.12 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | 2-(6-chloro-1-methylindazol-3-yl)-N-[(2S)-1-methoxypropan-2-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | COC[C@H](C)NC(=O)c1cn(COCC[Si](C)(C)C)c2ncc(-c3nn(C)c4cc(Cl)ccc34)nc12 |
| InChI | InChI=1S/C25H33ClN6O3Si/c1-16(14-34-3)28-25(33)19-13-32(15-35-9-10-36(4,5)6)24-23(19)29-20(12-27-24)22-18-8-7-17(26)11-21(18)31(2)30-22/h7-8,11-13,16H,9-10,14-15H2,1-6H3,(H,28,33)/t16-/m0/s1 |
| InChIKey | NTMKGHVNRLYPOK-INIZCTEOSA-N |
| XLogP | 4.72 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.12 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|