C27H37FN6O3Si — CID 71286099
2-(6-fluoro-1-methylindazol-3-yl)-N-[(2S)-1-hydroxy-4-methylpentan-2-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 71286099) has the molecular formula C27H37FN6O3Si and a molecular weight of 540.72 g/mol. Its IUPAC name is 2-(6-fluoro-1-methylindazol-3-yl)-N-[(2S)-1-hydroxy-4-methylpentan-2-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | 2-(6-fluoro-1-methylindazol-3-yl)-N-[(2S)-1-hydroxy-4-methylpentan-2-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 71286099 |
| Molecular Formula | C27H37FN6O3Si |
| Molecular Weight | 540.72 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | 2-(6-fluoro-1-methylindazol-3-yl)-N-[(2S)-1-hydroxy-4-methylpentan-2-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | CC(C)C[C@@H](CO)NC(=O)c1cn(COCC[Si](C)(C)C)c2ncc(-c3nn(C)c4cc(F)ccc34)nc12 |
| InChI | InChI=1S/C27H37FN6O3Si/c1-17(2)11-19(15-35)30-27(36)21-14-34(16-37-9-10-38(4,5)6)26-25(21)31-22(13-29-26)24-20-8-7-18(28)12-23(20)33(3)32-24/h7-8,12-14,17,19,35H,9-11,15-16H2,1-6H3,(H,30,36)/t19-/m0/s1 |
| InChIKey | LAKIPACKHNTSSM-IBGZPJMESA-N |
| XLogP | 4.57 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.72 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|