About (2S)-2-(trifluoromethyl)-1,3-oxathiolan-5-one
(2S)-2-(trifluoromethyl)-1,3-oxathiolan-5-one (PubChem CID 7128612) has the molecular formula C4H3F3O2S
and a molecular weight of 172.13 g/mol. Its IUPAC name is (2S)-2-(trifluoromethyl)-1,3-oxathiolan-5-one.
Molecular Properties
| Compound Name | (2S)-2-(trifluoromethyl)-1,3-oxathiolan-5-one |
| PubChem CID | 7128612 |
| Molecular Formula | C4H3F3O2S |
| Molecular Weight | 172.13 g/mol |
| Exact Mass | 171.98 |
| IUPAC Name | (2S)-2-(trifluoromethyl)-1,3-oxathiolan-5-one |
| SMILES | O=C1CS[C@@H](C(F)(F)F)O1 |
| InChI | InChI=1S/C4H3F3O2S/c5-4(6,7)3-9-2(8)1-10-3/h3H,1H2/t3-/m0/s1 |
| InChIKey | BYWPRQGFDWGIGV-VKHMYHEASA-N |
| XLogP | 1.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.13 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-(trifluoromethyl)-1,3-oxathiolan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(trifluoromethyl)-1,3-oxathiolan-5-one?
The IUPAC name of (2S)-2-(trifluoromethyl)-1,3-oxathiolan-5-one (CID 7128612) is (2S)-2-(trifluoromethyl)-1,3-oxathiolan-5-one.
What is the SMILES notation for (2S)-2-(trifluoromethyl)-1,3-oxathiolan-5-one?
The canonical SMILES for (2S)-2-(trifluoromethyl)-1,3-oxathiolan-5-one is O=C1CS[C@@H](C(F)(F)F)O1.
What is the InChIKey of (2S)-2-(trifluoromethyl)-1,3-oxathiolan-5-one?
The InChIKey is BYWPRQGFDWGIGV-VKHMYHEASA-N. The full InChI is InChI=1S/C4H3F3O2S/c5-4(6,7)3-9-2(8)1-10-3/h3H,1H2/t3-/m0/s1.
What are the key properties of (2S)-2-(trifluoromethyl)-1,3-oxathiolan-5-one?
(2S)-2-(trifluoromethyl)-1,3-oxathiolan-5-one has a molecular weight of 172.13 g/mol, XLogP of 1.16, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(trifluoromethyl)-1,3-oxathiolan-5-one is sourced from PubChem (CID 7128612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).