C30H26F4N8O — CID 71286145
2-[1-[(2-fluorophenyl)methyl]-6-methylpyrazolo[3,4-d]pyrimidin-3-yl]-5,5-dimethyl-4-[N-(3,3,3-trifluoropropyl)anilino]-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 71286145) has the molecular formula C30H26F4N8O and a molecular weight of 590.59 g/mol. Its IUPAC name is 2-[1-[(2-fluorophenyl)methyl]-6-methylpyrazolo[3,4-d]pyrimidin-3-yl]-5,5-dimethyl-4-[N-(3,3,3-trifluoropropyl)anilino]-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 2-[1-[(2-fluorophenyl)methyl]-6-methylpyrazolo[3,4-d]pyrimidin-3-yl]-5,5-dimethyl-4-[N-(3,3,3-trifluoropropyl)anilino]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 71286145 |
| Molecular Formula | C30H26F4N8O |
| Molecular Weight | 590.59 g/mol |
| Exact Mass | 590.22 |
| IUPAC Name | 2-[1-[(2-fluorophenyl)methyl]-6-methylpyrazolo[3,4-d]pyrimidin-3-yl]-5,5-dimethyl-4-[N-(3,3,3-trifluoropropyl)anilino]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | Cc1ncc2c(-c3nc4c(c(N(CCC(F)(F)F)c5ccccc5)n3)C(C)(C)C(=O)N4)nn(Cc3ccccc3F)c2n1 |
| InChI | InChI=1S/C30H26F4N8O/c1-17-35-15-20-23(40-42(26(20)36-17)16-18-9-7-8-12-21(18)31)25-37-24-22(29(2,3)28(43)39-24)27(38-25)41(14-13-30(32,33)34)19-10-5-4-6-11-19/h4-12,15H,13-14,16H2,1-3H3,(H,37,38,39,43) |
| InChIKey | NNZWIDMEABCQTP-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 101.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.59 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |