C23H23NO3S — CID 71286580
methyl 5-[3-[(1S,2S,3R,5R)-5-cyano-3-hydroxy-2-(2-phenylethynyl)cyclopentyl]propyl]thiophene-2-carboxylate (PubChem CID 71286580) has the molecular formula C23H23NO3S and a molecular weight of 393.51 g/mol. Its IUPAC name is methyl 5-[3-[(1S,2S,3R,5R)-5-cyano-3-hydroxy-2-(2-phenylethynyl)cyclopentyl]propyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[3-[(1S,2S,3R,5R)-5-cyano-3-hydroxy-2-(2-phenylethynyl)cyclopentyl]propyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 71286580 |
| Molecular Formula | C23H23NO3S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | methyl 5-[3-[(1S,2S,3R,5R)-5-cyano-3-hydroxy-2-(2-phenylethynyl)cyclopentyl]propyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(CCC[C@@H]2[C@@H](C#Cc3ccccc3)[C@H](O)C[C@H]2C#N)s1 |
| InChI | InChI=1S/C23H23NO3S/c1-27-23(26)22-13-11-18(28-22)8-5-9-19-17(15-24)14-21(25)20(19)12-10-16-6-3-2-4-7-16/h2-4,6-7,11,13,17,19-21,25H,5,8-9,14H2,1H3/t17-,19-,20+,21+/m0/s1 |
| InChIKey | SBQHRBHYNKWXBB-MJUUVYJYSA-N |
| XLogP | 4.05 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|