C56H43N3Si — CID 71286923
[4-[3-[9-[4-(4,6-diphenyl-2-pyridinyl)phenyl]carbazol-3-yl]carbazol-9-yl]phenyl]-trimethylsilane (PubChem CID 71286923) has the molecular formula C56H43N3Si and a molecular weight of 786.07 g/mol. Its IUPAC name is [4-[3-[9-[4-(4,6-diphenyl-2-pyridinyl)phenyl]carbazol-3-yl]carbazol-9-yl]phenyl]-trimethylsilane.
| Compound Name | [4-[3-[9-[4-(4,6-diphenyl-2-pyridinyl)phenyl]carbazol-3-yl]carbazol-9-yl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 71286923 |
| Molecular Formula | C56H43N3Si |
| Molecular Weight | 786.07 g/mol |
| Exact Mass | 785.32 |
| IUPAC Name | [4-[3-[9-[4-(4,6-diphenyl-2-pyridinyl)phenyl]carbazol-3-yl]carbazol-9-yl]phenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccc(-n2c3ccccc3c3cc(-c4ccc5c(c4)c4ccccc4n5-c4ccc(-c5cc(-c6ccccc6)cc(-c6ccccc6)n5)cc4)ccc32)cc1 |
| InChI | InChI=1S/C56H43N3Si/c1-60(2,3)46-30-28-45(29-31-46)59-54-21-13-11-19-48(54)50-35-42(25-33-56(50)59)41-24-32-55-49(34-41)47-18-10-12-20-53(47)58(55)44-26-22-40(23-27-44)52-37-43(38-14-6-4-7-15-38)36-51(57-52)39-16-8-5-9-17-39/h4-37H,1-3H3 |
| InChIKey | RZNOXKVQAWNZQW-UHFFFAOYSA-N |
| XLogP | 14.49 |
| TPSA | 22.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.07 |
| LogP ≤ 5 | 14.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|