C10H12Br2O4S — CID 71286970
5,7-dibromo-3-(2-methoxyethoxymethyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 71286970) has the molecular formula C10H12Br2O4S and a molecular weight of 388.08 g/mol. Its IUPAC name is 5,7-dibromo-3-(2-methoxyethoxymethyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine.
| Compound Name | 5,7-dibromo-3-(2-methoxyethoxymethyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 71286970 |
| Molecular Formula | C10H12Br2O4S |
| Molecular Weight | 388.08 g/mol |
| Exact Mass | 385.88 |
| IUPAC Name | 5,7-dibromo-3-(2-methoxyethoxymethyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | COCCOCC1COc2c(Br)sc(Br)c2O1 |
| InChI | InChI=1S/C10H12Br2O4S/c1-13-2-3-14-4-6-5-15-7-8(16-6)10(12)17-9(7)11/h6H,2-5H2,1H3 |
| InChIKey | XPSQNWDWXOXHLD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.08 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|