About 2,2-ditert-butylazepane
2,2-ditert-butylazepane (PubChem CID 71287765) has the molecular formula C14H29N
and a molecular weight of 211.39 g/mol. Its IUPAC name is 2,2-ditert-butylazepane.
Molecular Properties
| Compound Name | 2,2-ditert-butylazepane |
| PubChem CID | 71287765 |
| Molecular Formula | C14H29N |
| Molecular Weight | 211.39 g/mol |
| Exact Mass | 211.23 |
| IUPAC Name | 2,2-ditert-butylazepane |
| SMILES | CC(C)(C)C1(C(C)(C)C)CCCCCN1 |
| InChI | InChI=1S/C14H29N/c1-12(2,3)14(13(4,5)6)10-8-7-9-11-15-14/h15H,7-11H2,1-6H3 |
| InChIKey | MQWUTHVONGZHDU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.39 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2-ditert-butylazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-ditert-butylazepane?
The IUPAC name of 2,2-ditert-butylazepane (CID 71287765) is 2,2-ditert-butylazepane.
What is the SMILES notation for 2,2-ditert-butylazepane?
The canonical SMILES for 2,2-ditert-butylazepane is CC(C)(C)C1(C(C)(C)C)CCCCCN1.
What is the InChIKey of 2,2-ditert-butylazepane?
The InChIKey is MQWUTHVONGZHDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29N/c1-12(2,3)14(13(4,5)6)10-8-7-9-11-15-14/h15H,7-11H2,1-6H3.
What are the key properties of 2,2-ditert-butylazepane?
2,2-ditert-butylazepane has a molecular weight of 211.39 g/mol, XLogP of 3.98, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-ditert-butylazepane is sourced from PubChem (CID 71287765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).