About 9-methyl-2-(morpholin-4-ylmethyl)-4H-[1,3]thiazolo[5,4-c]isoquinolin-5-one
9-methyl-2-(morpholin-4-ylmethyl)-4H-[1,3]thiazolo[5,4-c]isoquinolin-5-one (PubChem CID 71287880) has the molecular formula C16H17N3O2S
and a molecular weight of 315.40 g/mol. Its IUPAC name is 9-methyl-2-(morpholin-4-ylmethyl)-4H-[1,3]thiazolo[5,4-c]isoquinolin-5-one.
Molecular Properties
| Compound Name | 9-methyl-2-(morpholin-4-ylmethyl)-4H-[1,3]thiazolo[5,4-c]isoquinolin-5-one |
| PubChem CID | 71287880 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 9-methyl-2-(morpholin-4-ylmethyl)-4H-[1,3]thiazolo[5,4-c]isoquinolin-5-one |
| SMILES | Cc1cccc2c(=O)[nH]c3sc(CN4CCOCC4)nc3c12 |
| InChI | InChI=1S/C16H17N3O2S/c1-10-3-2-4-11-13(10)14-16(18-15(11)20)22-12(17-14)9-19-5-7-21-8-6-19/h2-4H,5-9H2,1H3,(H,18,20) |
| InChIKey | MONPZRSEHQOAQZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 9-methyl-2-(morpholin-4-ylmethyl)-4H-[1,3]thiazolo[5,4-c]isoquinolin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyl-2-(morpholin-4-ylmethyl)-4H-[1,3]thiazolo[5,4-c]isoquinolin-5-one?
The IUPAC name of 9-methyl-2-(morpholin-4-ylmethyl)-4H-[1,3]thiazolo[5,4-c]isoquinolin-5-one (CID 71287880) is 9-methyl-2-(morpholin-4-ylmethyl)-4H-[1,3]thiazolo[5,4-c]isoquinolin-5-one.
What is the SMILES notation for 9-methyl-2-(morpholin-4-ylmethyl)-4H-[1,3]thiazolo[5,4-c]isoquinolin-5-one?
The canonical SMILES for 9-methyl-2-(morpholin-4-ylmethyl)-4H-[1,3]thiazolo[5,4-c]isoquinolin-5-one is Cc1cccc2c(=O)[nH]c3sc(CN4CCOCC4)nc3c12.
What is the InChIKey of 9-methyl-2-(morpholin-4-ylmethyl)-4H-[1,3]thiazolo[5,4-c]isoquinolin-5-one?
The InChIKey is MONPZRSEHQOAQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O2S/c1-10-3-2-4-11-13(10)14-16(18-15(11)20)22-12(17-14)9-19-5-7-21-8-6-19/h2-4H,5-9H2,1H3,(H,18,20).
What are the key properties of 9-methyl-2-(morpholin-4-ylmethyl)-4H-[1,3]thiazolo[5,4-c]isoquinolin-5-one?
9-methyl-2-(morpholin-4-ylmethyl)-4H-[1,3]thiazolo[5,4-c]isoquinolin-5-one has a molecular weight of 315.40 g/mol, XLogP of 2.28, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyl-2-(morpholin-4-ylmethyl)-4H-[1,3]thiazolo[5,4-c]isoquinolin-5-one is sourced from PubChem (CID 71287880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).