C16H29NO13 — CID 71287920
(2R,5R)-5-acetamido-4-hydroxy-2-[(3R)-2,3,4,5-tetrahydroxypentoxy]-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid (PubChem CID 71287920) has the molecular formula C16H29NO13 and a molecular weight of 443.40 g/mol. Its IUPAC name is (2R,5R)-5-acetamido-4-hydroxy-2-[(3R)-2,3,4,5-tetrahydroxypentoxy]-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid.
| Compound Name | (2R,5R)-5-acetamido-4-hydroxy-2-[(3R)-2,3,4,5-tetrahydroxypentoxy]-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 71287920 |
| Molecular Formula | C16H29NO13 |
| Molecular Weight | 443.40 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | (2R,5R)-5-acetamido-4-hydroxy-2-[(3R)-2,3,4,5-tetrahydroxypentoxy]-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
| SMILES | CC(=O)N[C@@H]1C(O)C[C@](OCC(O)[C@H](O)C(O)CO)(C(=O)O)OC1[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C16H29NO13/c1-6(20)17-11-7(21)2-16(15(27)28,30-14(11)13(26)9(23)4-19)29-5-10(24)12(25)8(22)3-18/h7-14,18-19,21-26H,2-5H2,1H3,(H,17,20)(H,27,28)/t7?,8?,9-,10?,11-,12-,13-,14?,16-/m1/s1 |
| InChIKey | QSMIZLMBKWVGPH-STONCBGOSA-N |
| XLogP | -5.77 |
| TPSA | 246.70 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.40 |
| LogP ≤ 5 | -5.77 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |