About 3-(4-bromophenyl)-1,5-dipyridin-2-ylpentane-1,5-dione
3-(4-bromophenyl)-1,5-dipyridin-2-ylpentane-1,5-dione (PubChem CID 71288133) has the molecular formula C21H17BrN2O2
and a molecular weight of 409.28 g/mol. Its IUPAC name is 3-(4-bromophenyl)-1,5-dipyridin-2-ylpentane-1,5-dione.
Molecular Properties
| Compound Name | 3-(4-bromophenyl)-1,5-dipyridin-2-ylpentane-1,5-dione |
| PubChem CID | 71288133 |
| Molecular Formula | C21H17BrN2O2 |
| Molecular Weight | 409.28 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | 3-(4-bromophenyl)-1,5-dipyridin-2-ylpentane-1,5-dione |
| SMILES | O=C(CC(CC(=O)c1ccccn1)c1ccc(Br)cc1)c1ccccn1 |
| InChI | InChI=1S/C21H17BrN2O2/c22-17-9-7-15(8-10-17)16(13-20(25)18-5-1-3-11-23-18)14-21(26)19-6-2-4-12-24-19/h1-12,16H,13-14H2 |
| InChIKey | YOPLNEJYUKAJCV-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.28 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(4-bromophenyl)-1,5-dipyridin-2-ylpentane-1,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromophenyl)-1,5-dipyridin-2-ylpentane-1,5-dione?
The IUPAC name of 3-(4-bromophenyl)-1,5-dipyridin-2-ylpentane-1,5-dione (CID 71288133) is 3-(4-bromophenyl)-1,5-dipyridin-2-ylpentane-1,5-dione.
What is the SMILES notation for 3-(4-bromophenyl)-1,5-dipyridin-2-ylpentane-1,5-dione?
The canonical SMILES for 3-(4-bromophenyl)-1,5-dipyridin-2-ylpentane-1,5-dione is O=C(CC(CC(=O)c1ccccn1)c1ccc(Br)cc1)c1ccccn1.
What is the InChIKey of 3-(4-bromophenyl)-1,5-dipyridin-2-ylpentane-1,5-dione?
The InChIKey is YOPLNEJYUKAJCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17BrN2O2/c22-17-9-7-15(8-10-17)16(13-20(25)18-5-1-3-11-23-18)14-21(26)19-6-2-4-12-24-19/h1-12,16H,13-14H2.
What are the key properties of 3-(4-bromophenyl)-1,5-dipyridin-2-ylpentane-1,5-dione?
3-(4-bromophenyl)-1,5-dipyridin-2-ylpentane-1,5-dione has a molecular weight of 409.28 g/mol, XLogP of 4.87, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromophenyl)-1,5-dipyridin-2-ylpentane-1,5-dione is sourced from PubChem (CID 71288133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).