C24H30F2N6O3Si — CID 71288189
2-(6,8-difluoroimidazo[1,5-a]pyridin-1-yl)-N-[(2S)-1-methoxypropan-2-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 71288189) has the molecular formula C24H30F2N6O3Si and a molecular weight of 516.63 g/mol. Its IUPAC name is 2-(6,8-difluoroimidazo[1,5-a]pyridin-1-yl)-N-[(2S)-1-methoxypropan-2-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | 2-(6,8-difluoroimidazo[1,5-a]pyridin-1-yl)-N-[(2S)-1-methoxypropan-2-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 71288189 |
| Molecular Formula | C24H30F2N6O3Si |
| Molecular Weight | 516.63 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | 2-(6,8-difluoroimidazo[1,5-a]pyridin-1-yl)-N-[(2S)-1-methoxypropan-2-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | COC[C@H](C)NC(=O)c1cn(COCC[Si](C)(C)C)c2ncc(-c3ncn4cc(F)cc(F)c34)nc12 |
| InChI | InChI=1S/C24H30F2N6O3Si/c1-15(12-34-2)29-24(33)17-11-32(14-35-6-7-36(3,4)5)23-20(17)30-19(9-27-23)21-22-18(26)8-16(25)10-31(22)13-28-21/h8-11,13,15H,6-7,12,14H2,1-5H3,(H,29,33)/t15-/m0/s1 |
| InChIKey | YJSIPMFGFGKMJX-HNNXBMFYSA-N |
| XLogP | 4.10 |
| TPSA | 95.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.63 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|