C23H44BNO5Si — CID 71288625
methyl 3-[tert-butyl(dimethyl)silyl]oxy-4-[2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethylamino]butanoate (PubChem CID 71288625) has the molecular formula C23H44BNO5Si and a molecular weight of 453.51 g/mol. Its IUPAC name is methyl 3-[tert-butyl(dimethyl)silyl]oxy-4-[2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethylamino]butanoate.
| Compound Name | methyl 3-[tert-butyl(dimethyl)silyl]oxy-4-[2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethylamino]butanoate |
|---|---|
| PubChem CID | 71288625 |
| Molecular Formula | C23H44BNO5Si |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.31 |
| IUPAC Name | methyl 3-[tert-butyl(dimethyl)silyl]oxy-4-[2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethylamino]butanoate |
| SMILES | COC(=O)CC(CNCCB1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H44BNO5Si/c1-21(2,3)31(8,9)29-17(14-20(26)27-7)15-25-11-10-24-28-19-13-16-12-18(22(16,4)5)23(19,6)30-24/h16-19,25H,10-15H2,1-9H3/t16-,17?,18-,19+,23-/m0/s1 |
| InChIKey | AAYFZUDDYNBIBK-VVHFPVQTSA-N |
| XLogP | 4.26 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|