About 2,3-ditert-butylindazole
2,3-ditert-butylindazole (PubChem CID 71288886) has the molecular formula C15H22N2
and a molecular weight of 230.35 g/mol. Its IUPAC name is 2,3-ditert-butylindazole.
Molecular Properties
| Compound Name | 2,3-ditert-butylindazole |
| PubChem CID | 71288886 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 2,3-ditert-butylindazole |
| SMILES | CC(C)(C)c1c2ccccc2nn1C(C)(C)C |
| InChI | InChI=1S/C15H22N2/c1-14(2,3)13-11-9-7-8-10-12(11)16-17(13)15(4,5)6/h7-10H,1-6H3 |
| InChIKey | SVSPXGBSZWZQKH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-ditert-butylindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-ditert-butylindazole?
The IUPAC name of 2,3-ditert-butylindazole (CID 71288886) is 2,3-ditert-butylindazole.
What is the SMILES notation for 2,3-ditert-butylindazole?
The canonical SMILES for 2,3-ditert-butylindazole is CC(C)(C)c1c2ccccc2nn1C(C)(C)C.
What is the InChIKey of 2,3-ditert-butylindazole?
The InChIKey is SVSPXGBSZWZQKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2/c1-14(2,3)13-11-9-7-8-10-12(11)16-17(13)15(4,5)6/h7-10H,1-6H3.
What are the key properties of 2,3-ditert-butylindazole?
2,3-ditert-butylindazole has a molecular weight of 230.35 g/mol, XLogP of 4.09, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-ditert-butylindazole is sourced from PubChem (CID 71288886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).