About 2,3-ditert-butylimidazo[1,2-b]pyridazine
2,3-ditert-butylimidazo[1,2-b]pyridazine (PubChem CID 71288892) has the molecular formula C14H21N3
and a molecular weight of 231.34 g/mol. Its IUPAC name is 2,3-ditert-butylimidazo[1,2-b]pyridazine.
Molecular Properties
| Compound Name | 2,3-ditert-butylimidazo[1,2-b]pyridazine |
| PubChem CID | 71288892 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 2,3-ditert-butylimidazo[1,2-b]pyridazine |
| SMILES | CC(C)(C)c1nc2cccnn2c1C(C)(C)C |
| InChI | InChI=1S/C14H21N3/c1-13(2,3)11-12(14(4,5)6)17-10(16-11)8-7-9-15-17/h7-9H,1-6H3 |
| InChIKey | PXMPJDIFPYJQLA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-ditert-butylimidazo[1,2-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-ditert-butylimidazo[1,2-b]pyridazine?
The IUPAC name of 2,3-ditert-butylimidazo[1,2-b]pyridazine (CID 71288892) is 2,3-ditert-butylimidazo[1,2-b]pyridazine.
What is the SMILES notation for 2,3-ditert-butylimidazo[1,2-b]pyridazine?
The canonical SMILES for 2,3-ditert-butylimidazo[1,2-b]pyridazine is CC(C)(C)c1nc2cccnn2c1C(C)(C)C.
What is the InChIKey of 2,3-ditert-butylimidazo[1,2-b]pyridazine?
The InChIKey is PXMPJDIFPYJQLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3/c1-13(2,3)11-12(14(4,5)6)17-10(16-11)8-7-9-15-17/h7-9H,1-6H3.
What are the key properties of 2,3-ditert-butylimidazo[1,2-b]pyridazine?
2,3-ditert-butylimidazo[1,2-b]pyridazine has a molecular weight of 231.34 g/mol, XLogP of 3.32, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-ditert-butylimidazo[1,2-b]pyridazine is sourced from PubChem (CID 71288892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).