C23H31FN6O2S — CID 71289140
N-[4-[[6-(butylamino)-3-(4-fluorophenyl)pyrazolo[3,4-d]pyrimidin-1-yl]methyl]cyclohexyl]methanesulfonamide (PubChem CID 71289140) has the molecular formula C23H31FN6O2S and a molecular weight of 474.61 g/mol. Its IUPAC name is N-[4-[[6-(butylamino)-3-(4-fluorophenyl)pyrazolo[3,4-d]pyrimidin-1-yl]methyl]cyclohexyl]methanesulfonamide.
| Compound Name | N-[4-[[6-(butylamino)-3-(4-fluorophenyl)pyrazolo[3,4-d]pyrimidin-1-yl]methyl]cyclohexyl]methanesulfonamide |
|---|---|
| PubChem CID | 71289140 |
| Molecular Formula | C23H31FN6O2S |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | N-[4-[[6-(butylamino)-3-(4-fluorophenyl)pyrazolo[3,4-d]pyrimidin-1-yl]methyl]cyclohexyl]methanesulfonamide |
| SMILES | CCCCNc1ncc2c(-c3ccc(F)cc3)nn(CC3CCC(NS(C)(=O)=O)CC3)c2n1 |
| InChI | InChI=1S/C23H31FN6O2S/c1-3-4-13-25-23-26-14-20-21(17-7-9-18(24)10-8-17)28-30(22(20)27-23)15-16-5-11-19(12-6-16)29-33(2,31)32/h7-10,14,16,19,29H,3-6,11-13,15H2,1-2H3,(H,25,26,27) |
| InChIKey | CHLHKBOYPIWJQE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|