C31H38FN7O — CID 71289144
1-[(4-aminocyclohexyl)methyl]-N-[3-(4-fluorophenyl)propyl]-3-(4-morpholin-4-ylphenyl)pyrazolo[3,4-d]pyrimidin-6-amine (PubChem CID 71289144) has the molecular formula C31H38FN7O and a molecular weight of 543.69 g/mol. Its IUPAC name is 1-[(4-aminocyclohexyl)methyl]-N-[3-(4-fluorophenyl)propyl]-3-(4-morpholin-4-ylphenyl)pyrazolo[3,4-d]pyrimidin-6-amine.
| Compound Name | 1-[(4-aminocyclohexyl)methyl]-N-[3-(4-fluorophenyl)propyl]-3-(4-morpholin-4-ylphenyl)pyrazolo[3,4-d]pyrimidin-6-amine |
|---|---|
| PubChem CID | 71289144 |
| Molecular Formula | C31H38FN7O |
| Molecular Weight | 543.69 g/mol |
| Exact Mass | 543.31 |
| IUPAC Name | 1-[(4-aminocyclohexyl)methyl]-N-[3-(4-fluorophenyl)propyl]-3-(4-morpholin-4-ylphenyl)pyrazolo[3,4-d]pyrimidin-6-amine |
| SMILES | NC1CCC(Cn2nc(-c3ccc(N4CCOCC4)cc3)c3cnc(NCCCc4ccc(F)cc4)nc32)CC1 |
| InChI | InChI=1S/C31H38FN7O/c32-25-9-3-22(4-10-25)2-1-15-34-31-35-20-28-29(24-7-13-27(14-8-24)38-16-18-40-19-17-38)37-39(30(28)36-31)21-23-5-11-26(33)12-6-23/h3-4,7-10,13-14,20,23,26H,1-2,5-6,11-12,15-19,21,33H2,(H,34,35,36) |
| InChIKey | WFBDLOLBHRKROB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 94.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.69 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|