C23H32N6O3S — CID 71289187
4-[6-(butylamino)-1-(4-hydroxycyclohexyl)pyrazolo[3,4-d]pyrimidin-3-yl]-N-ethylbenzenesulfonamide (PubChem CID 71289187) has the molecular formula C23H32N6O3S and a molecular weight of 472.62 g/mol. Its IUPAC name is 4-[6-(butylamino)-1-(4-hydroxycyclohexyl)pyrazolo[3,4-d]pyrimidin-3-yl]-N-ethylbenzenesulfonamide.
| Compound Name | 4-[6-(butylamino)-1-(4-hydroxycyclohexyl)pyrazolo[3,4-d]pyrimidin-3-yl]-N-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 71289187 |
| Molecular Formula | C23H32N6O3S |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | 4-[6-(butylamino)-1-(4-hydroxycyclohexyl)pyrazolo[3,4-d]pyrimidin-3-yl]-N-ethylbenzenesulfonamide |
| SMILES | CCCCNc1ncc2c(-c3ccc(S(=O)(=O)NCC)cc3)nn(C3CCC(O)CC3)c2n1 |
| InChI | InChI=1S/C23H32N6O3S/c1-3-5-14-24-23-25-15-20-21(16-6-12-19(13-7-16)33(31,32)26-4-2)28-29(22(20)27-23)17-8-10-18(30)11-9-17/h6-7,12-13,15,17-18,26,30H,3-5,8-11,14H2,1-2H3,(H,24,25,27) |
| InChIKey | VTMQYPWKWYVLIV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|