C27H38FN7O — CID 71289198
1-[(4-aminocyclohexyl)methyl]-N-butyl-3-[3-fluoro-4-(morpholin-4-ylmethyl)phenyl]pyrazolo[3,4-d]pyrimidin-6-amine (PubChem CID 71289198) has the molecular formula C27H38FN7O and a molecular weight of 495.65 g/mol. Its IUPAC name is 1-[(4-aminocyclohexyl)methyl]-N-butyl-3-[3-fluoro-4-(morpholin-4-ylmethyl)phenyl]pyrazolo[3,4-d]pyrimidin-6-amine.
| Compound Name | 1-[(4-aminocyclohexyl)methyl]-N-butyl-3-[3-fluoro-4-(morpholin-4-ylmethyl)phenyl]pyrazolo[3,4-d]pyrimidin-6-amine |
|---|---|
| PubChem CID | 71289198 |
| Molecular Formula | C27H38FN7O |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.31 |
| IUPAC Name | 1-[(4-aminocyclohexyl)methyl]-N-butyl-3-[3-fluoro-4-(morpholin-4-ylmethyl)phenyl]pyrazolo[3,4-d]pyrimidin-6-amine |
| SMILES | CCCCNc1ncc2c(-c3ccc(CN4CCOCC4)c(F)c3)nn(CC3CCC(N)CC3)c2n1 |
| InChI | InChI=1S/C27H38FN7O/c1-2-3-10-30-27-31-16-23-25(33-35(26(23)32-27)17-19-4-8-22(29)9-5-19)20-6-7-21(24(28)15-20)18-34-11-13-36-14-12-34/h6-7,15-16,19,22H,2-5,8-14,17-18,29H2,1H3,(H,30,31,32) |
| InChIKey | ZNMDSXRLDNVRKI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 94.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|