C23H32N8O — CID 71289202
4-[1-[(4-aminocyclohexyl)methyl]-6-(butylamino)pyrazolo[3,4-d]pyrimidin-3-yl]benzohydrazide (PubChem CID 71289202) has the molecular formula C23H32N8O and a molecular weight of 436.56 g/mol. Its IUPAC name is 4-[1-[(4-aminocyclohexyl)methyl]-6-(butylamino)pyrazolo[3,4-d]pyrimidin-3-yl]benzohydrazide.
| Compound Name | 4-[1-[(4-aminocyclohexyl)methyl]-6-(butylamino)pyrazolo[3,4-d]pyrimidin-3-yl]benzohydrazide |
|---|---|
| PubChem CID | 71289202 |
| Molecular Formula | C23H32N8O |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | 4-[1-[(4-aminocyclohexyl)methyl]-6-(butylamino)pyrazolo[3,4-d]pyrimidin-3-yl]benzohydrazide |
| SMILES | CCCCNc1ncc2c(-c3ccc(C(=O)NN)cc3)nn(CC3CCC(N)CC3)c2n1 |
| InChI | InChI=1S/C23H32N8O/c1-2-3-12-26-23-27-13-19-20(16-6-8-17(9-7-16)22(32)29-25)30-31(21(19)28-23)14-15-4-10-18(24)11-5-15/h6-9,13,15,18H,2-5,10-12,14,24-25H2,1H3,(H,29,32)(H,26,27,28) |
| InChIKey | FWXMVFLWOBNUHN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 136.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|