C26H35N7O2 — CID 71289205
4-[4-[1-[(4-aminocyclohexyl)methyl]-6-(butylamino)pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]morpholin-3-one (PubChem CID 71289205) has the molecular formula C26H35N7O2 and a molecular weight of 477.61 g/mol. Its IUPAC name is 4-[4-[1-[(4-aminocyclohexyl)methyl]-6-(butylamino)pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]morpholin-3-one.
| Compound Name | 4-[4-[1-[(4-aminocyclohexyl)methyl]-6-(butylamino)pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]morpholin-3-one |
|---|---|
| PubChem CID | 71289205 |
| Molecular Formula | C26H35N7O2 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.29 |
| IUPAC Name | 4-[4-[1-[(4-aminocyclohexyl)methyl]-6-(butylamino)pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]morpholin-3-one |
| SMILES | CCCCNc1ncc2c(-c3ccc(N4CCOCC4=O)cc3)nn(CC3CCC(N)CC3)c2n1 |
| InChI | InChI=1S/C26H35N7O2/c1-2-3-12-28-26-29-15-22-24(19-6-10-21(11-7-19)32-13-14-35-17-23(32)34)31-33(25(22)30-26)16-18-4-8-20(27)9-5-18/h6-7,10-11,15,18,20H,2-5,8-9,12-14,16-17,27H2,1H3,(H,28,29,30) |
| InChIKey | NMNFFBOFPSAYQW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 111.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|