C32H36FN7O3 — CID 71289212
1-N-[4-[6-(butylamino)-1-(4-hydroxycyclohexyl)pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 71289212) has the molecular formula C32H36FN7O3 and a molecular weight of 585.68 g/mol. Its IUPAC name is 1-N-[4-[6-(butylamino)-1-(4-hydroxycyclohexyl)pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-[4-[6-(butylamino)-1-(4-hydroxycyclohexyl)pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 71289212 |
| Molecular Formula | C32H36FN7O3 |
| Molecular Weight | 585.68 g/mol |
| Exact Mass | 585.29 |
| IUPAC Name | 1-N-[4-[6-(butylamino)-1-(4-hydroxycyclohexyl)pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | CCCCNc1ncc2c(-c3ccc(NC(=O)C4(C(=O)Nc5ccc(F)cc5)CC4)cc3)nn(C3CCC(O)CC3)c2n1 |
| InChI | InChI=1S/C32H36FN7O3/c1-2-3-18-34-31-35-19-26-27(39-40(28(26)38-31)24-12-14-25(41)15-13-24)20-4-8-22(9-5-20)36-29(42)32(16-17-32)30(43)37-23-10-6-21(33)7-11-23/h4-11,19,24-25,41H,2-3,12-18H2,1H3,(H,36,42)(H,37,43)(H,34,35,38) |
| InChIKey | GTKFLVJXKMSEHG-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 134.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.68 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|