C27H39N7O3S — CID 71289223
4-[6-(butylamino)-3-[4-(4-ethylpiperazin-1-yl)sulfonylphenyl]pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexan-1-ol (PubChem CID 71289223) has the molecular formula C27H39N7O3S and a molecular weight of 541.72 g/mol. Its IUPAC name is 4-[6-(butylamino)-3-[4-(4-ethylpiperazin-1-yl)sulfonylphenyl]pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexan-1-ol.
| Compound Name | 4-[6-(butylamino)-3-[4-(4-ethylpiperazin-1-yl)sulfonylphenyl]pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 71289223 |
| Molecular Formula | C27H39N7O3S |
| Molecular Weight | 541.72 g/mol |
| Exact Mass | 541.28 |
| IUPAC Name | 4-[6-(butylamino)-3-[4-(4-ethylpiperazin-1-yl)sulfonylphenyl]pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexan-1-ol |
| SMILES | CCCCNc1ncc2c(-c3ccc(S(=O)(=O)N4CCN(CC)CC4)cc3)nn(C3CCC(O)CC3)c2n1 |
| InChI | InChI=1S/C27H39N7O3S/c1-3-5-14-28-27-29-19-24-25(31-34(26(24)30-27)21-8-10-22(35)11-9-21)20-6-12-23(13-7-20)38(36,37)33-17-15-32(4-2)16-18-33/h6-7,12-13,19,21-22,35H,3-5,8-11,14-18H2,1-2H3,(H,28,29,30) |
| InChIKey | QZDAKXDADYSIIL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.72 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|