C27H38FN7O — CID 71289234
4-[6-(butylamino)-3-[4-(4-ethylpiperazin-1-yl)-3-fluorophenyl]pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexan-1-ol (PubChem CID 71289234) has the molecular formula C27H38FN7O and a molecular weight of 495.65 g/mol. Its IUPAC name is 4-[6-(butylamino)-3-[4-(4-ethylpiperazin-1-yl)-3-fluorophenyl]pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexan-1-ol.
| Compound Name | 4-[6-(butylamino)-3-[4-(4-ethylpiperazin-1-yl)-3-fluorophenyl]pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 71289234 |
| Molecular Formula | C27H38FN7O |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.31 |
| IUPAC Name | 4-[6-(butylamino)-3-[4-(4-ethylpiperazin-1-yl)-3-fluorophenyl]pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexan-1-ol |
| SMILES | CCCCNc1ncc2c(-c3ccc(N4CCN(CC)CC4)c(F)c3)nn(C3CCC(O)CC3)c2n1 |
| InChI | InChI=1S/C27H38FN7O/c1-3-5-12-29-27-30-18-22-25(32-35(26(22)31-27)20-7-9-21(36)10-8-20)19-6-11-24(23(28)17-19)34-15-13-33(4-2)14-16-34/h6,11,17-18,20-21,36H,3-5,7-10,12-16H2,1-2H3,(H,29,30,31) |
| InChIKey | VNBSIHDGTFVNQU-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 82.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|