C7H16NO3S+ — CID 7128943
[(3R)-1,1-dioxothiolan-3-yl]-(2-methoxyethyl)azanium (PubChem CID 7128943) has the molecular formula C7H16NO3S+ and a molecular weight of 194.28 g/mol. Its IUPAC name is [(3R)-1,1-dioxothiolan-3-yl]-(2-methoxyethyl)azanium.
| Compound Name | [(3R)-1,1-dioxothiolan-3-yl]-(2-methoxyethyl)azanium |
|---|---|
| PubChem CID | 7128943 |
| Molecular Formula | C7H16NO3S+ |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | [(3R)-1,1-dioxothiolan-3-yl]-(2-methoxyethyl)azanium |
| SMILES | COCC[NH2+][C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H15NO3S/c1-11-4-3-8-7-2-5-12(9,10)6-7/h7-8H,2-6H2,1H3/p+1/t7-/m1/s1 |
| InChIKey | JCUMFZWFXHIBPH-SSDOTTSWSA-O |
| XLogP | -1.62 |
| TPSA | 59.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|