C26H44OSi — CID 71289796
tert-butyl-dimethyl-[[(3S,10R,13S)-10,13,17-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]silane (PubChem CID 71289796) has the molecular formula C26H44OSi and a molecular weight of 400.72 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(3S,10R,13S)-10,13,17-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(3S,10R,13S)-10,13,17-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]silane |
|---|---|
| PubChem CID | 71289796 |
| Molecular Formula | C26H44OSi |
| Molecular Weight | 400.72 g/mol |
| Exact Mass | 400.32 |
| IUPAC Name | tert-butyl-dimethyl-[[(3S,10R,13S)-10,13,17-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]silane |
| SMILES | CC1=CCC2C3CC=C4C[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C26H44OSi/c1-18-9-12-22-21-11-10-19-17-20(27-28(7,8)24(2,3)4)13-15-26(19,6)23(21)14-16-25(18,22)5/h9-10,20-23H,11-17H2,1-8H3/t20-,21?,22?,23?,25+,26-/m0/s1 |
| InChIKey | LAMFTPYYLREOJV-KNSDLTJZSA-N |
| XLogP | 7.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.72 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|