About 2-benzamido-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide
2-benzamido-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide (PubChem CID 712900) has the molecular formula C15H14N2O2S
and a molecular weight of 286.36 g/mol. Its IUPAC name is 2-benzamido-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide.
Molecular Properties
| Compound Name | 2-benzamido-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
| PubChem CID | 712900 |
| Molecular Formula | C15H14N2O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 2-benzamido-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
| SMILES | NC(=O)c1c(NC(=O)c2ccccc2)sc2c1CCC2 |
| InChI | InChI=1S/C15H14N2O2S/c16-13(18)12-10-7-4-8-11(10)20-15(12)17-14(19)9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H2,16,18)(H,17,19) |
| InChIKey | WUXSRILVTCNVAY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-benzamido-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzamido-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide?
The IUPAC name of 2-benzamido-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide (CID 712900) is 2-benzamido-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide.
What is the SMILES notation for 2-benzamido-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide?
The canonical SMILES for 2-benzamido-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide is NC(=O)c1c(NC(=O)c2ccccc2)sc2c1CCC2.
What is the InChIKey of 2-benzamido-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide?
The InChIKey is WUXSRILVTCNVAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O2S/c16-13(18)12-10-7-4-8-11(10)20-15(12)17-14(19)9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H2,16,18)(H,17,19).
What are the key properties of 2-benzamido-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide?
2-benzamido-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide has a molecular weight of 286.36 g/mol, XLogP of 2.59, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzamido-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide is sourced from PubChem (CID 712900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).