C18H17ClN6O2 — CID 71290391
2-(6-chloro-1-methylindazol-3-yl)-N-(2-methoxyethyl)-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 71290391) has the molecular formula C18H17ClN6O2 and a molecular weight of 384.83 g/mol. Its IUPAC name is 2-(6-chloro-1-methylindazol-3-yl)-N-(2-methoxyethyl)-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | 2-(6-chloro-1-methylindazol-3-yl)-N-(2-methoxyethyl)-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 71290391 |
| Molecular Formula | C18H17ClN6O2 |
| Molecular Weight | 384.83 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 2-(6-chloro-1-methylindazol-3-yl)-N-(2-methoxyethyl)-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | COCCNC(=O)c1c[nH]c2ncc(-c3nn(C)c4cc(Cl)ccc34)nc12 |
| InChI | InChI=1S/C18H17ClN6O2/c1-25-14-7-10(19)3-4-11(14)15(24-25)13-9-22-17-16(23-13)12(8-21-17)18(26)20-5-6-27-2/h3-4,7-9H,5-6H2,1-2H3,(H,20,26)(H,21,22) |
| InChIKey | AZSCCGZYJBYOSH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.83 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|