C22H19ClN8O3 — CID 71290411
2-(5-chloroindazol-1-yl)-N-[(1R)-2-(4-cyanopiperidin-1-yl)-1-hydroxy-2-oxoethyl]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 71290411) has the molecular formula C22H19ClN8O3 and a molecular weight of 478.90 g/mol. Its IUPAC name is 2-(5-chloroindazol-1-yl)-N-[(1R)-2-(4-cyanopiperidin-1-yl)-1-hydroxy-2-oxoethyl]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | 2-(5-chloroindazol-1-yl)-N-[(1R)-2-(4-cyanopiperidin-1-yl)-1-hydroxy-2-oxoethyl]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 71290411 |
| Molecular Formula | C22H19ClN8O3 |
| Molecular Weight | 478.90 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | 2-(5-chloroindazol-1-yl)-N-[(1R)-2-(4-cyanopiperidin-1-yl)-1-hydroxy-2-oxoethyl]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | N#CC1CCN(C(=O)[C@@H](O)NC(=O)c2c[nH]c3ncc(-n4ncc5cc(Cl)ccc54)nc23)CC1 |
| InChI | InChI=1S/C22H19ClN8O3/c23-14-1-2-16-13(7-14)9-27-31(16)17-11-26-19-18(28-17)15(10-25-19)20(32)29-21(33)22(34)30-5-3-12(8-24)4-6-30/h1-2,7,9-12,21,33H,3-6H2,(H,25,26)(H,29,32)/t21-/m1/s1 |
| InChIKey | FRIJZSYHZCJZKE-OAQYLSRUSA-N |
| XLogP | 1.76 |
| TPSA | 152.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.90 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|