About N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-3-(3-methoxypropanoylamino)propanamide
N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-3-(3-methoxypropanoylamino)propanamide (PubChem CID 71290853) has the molecular formula C16H24N4O6
and a molecular weight of 368.39 g/mol. Its IUPAC name is N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-3-(3-methoxypropanoylamino)propanamide.
Molecular Properties
| Compound Name | N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-3-(3-methoxypropanoylamino)propanamide |
| PubChem CID | 71290853 |
| Molecular Formula | C16H24N4O6 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-3-(3-methoxypropanoylamino)propanamide |
| SMILES | COCCC(=O)NCCC(=O)NCCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C16H24N4O6/c1-26-11-6-14(23)17-7-4-12(21)18-8-9-19-13(22)5-10-20-15(24)2-3-16(20)25/h2-3H,4-11H2,1H3,(H,17,23)(H,18,21)(H,19,22) |
| InChIKey | RTEVJYWKIIAJFX-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-3-(3-methoxypropanoylamino)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-3-(3-methoxypropanoylamino)propanamide?
The IUPAC name of N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-3-(3-methoxypropanoylamino)propanamide (CID 71290853) is N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-3-(3-methoxypropanoylamino)propanamide.
What is the SMILES notation for N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-3-(3-methoxypropanoylamino)propanamide?
The canonical SMILES for N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-3-(3-methoxypropanoylamino)propanamide is COCCC(=O)NCCC(=O)NCCNC(=O)CCN1C(=O)C=CC1=O.
What is the InChIKey of N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-3-(3-methoxypropanoylamino)propanamide?
The InChIKey is RTEVJYWKIIAJFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N4O6/c1-26-11-6-14(23)17-7-4-12(21)18-8-9-19-13(22)5-10-20-15(24)2-3-16(20)25/h2-3H,4-11H2,1H3,(H,17,23)(H,18,21)(H,19,22).
What are the key properties of N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-3-(3-methoxypropanoylamino)propanamide?
N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-3-(3-methoxypropanoylamino)propanamide has a molecular weight of 368.39 g/mol, XLogP of -1.92, 12 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-3-(3-methoxypropanoylamino)propanamide is sourced from PubChem (CID 71290853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).