C15H15N3O4S — CID 71291563
2-methoxy-N-(1-methyl-2-oxo-3H-benzimidazol-5-yl)benzenesulfonamide (PubChem CID 71291563) has the molecular formula C15H15N3O4S and a molecular weight of 333.37 g/mol. Its IUPAC name is 2-methoxy-N-(1-methyl-2-oxo-3H-benzimidazol-5-yl)benzenesulfonamide.
| Compound Name | 2-methoxy-N-(1-methyl-2-oxo-3H-benzimidazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 71291563 |
| Molecular Formula | C15H15N3O4S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 2-methoxy-N-(1-methyl-2-oxo-3H-benzimidazol-5-yl)benzenesulfonamide |
| SMILES | COc1ccccc1S(=O)(=O)Nc1ccc2c(c1)[nH]c(=O)n2C |
| InChI | InChI=1S/C15H15N3O4S/c1-18-12-8-7-10(9-11(12)16-15(18)19)17-23(20,21)14-6-4-3-5-13(14)22-2/h3-9,17H,1-2H3,(H,16,19) |
| InChIKey | CELKZUUUTUIKNY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |