About 8-chloro-2-(2,2-dimethylpropyl)-3-propan-2-ylisoquinolin-1-one
8-chloro-2-(2,2-dimethylpropyl)-3-propan-2-ylisoquinolin-1-one (PubChem CID 71291782) has the molecular formula C17H22ClNO
and a molecular weight of 291.82 g/mol. Its IUPAC name is 8-chloro-2-(2,2-dimethylpropyl)-3-propan-2-ylisoquinolin-1-one.
Molecular Properties
| Compound Name | 8-chloro-2-(2,2-dimethylpropyl)-3-propan-2-ylisoquinolin-1-one |
| PubChem CID | 71291782 |
| Molecular Formula | C17H22ClNO |
| Molecular Weight | 291.82 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 8-chloro-2-(2,2-dimethylpropyl)-3-propan-2-ylisoquinolin-1-one |
| SMILES | CC(C)c1cc2cccc(Cl)c2c(=O)n1CC(C)(C)C |
| InChI | InChI=1S/C17H22ClNO/c1-11(2)14-9-12-7-6-8-13(18)15(12)16(20)19(14)10-17(3,4)5/h6-9,11H,10H2,1-5H3 |
| InChIKey | REWQPUJBRUUHRI-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.82 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-chloro-2-(2,2-dimethylpropyl)-3-propan-2-ylisoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-2-(2,2-dimethylpropyl)-3-propan-2-ylisoquinolin-1-one?
The IUPAC name of 8-chloro-2-(2,2-dimethylpropyl)-3-propan-2-ylisoquinolin-1-one (CID 71291782) is 8-chloro-2-(2,2-dimethylpropyl)-3-propan-2-ylisoquinolin-1-one.
What is the SMILES notation for 8-chloro-2-(2,2-dimethylpropyl)-3-propan-2-ylisoquinolin-1-one?
The canonical SMILES for 8-chloro-2-(2,2-dimethylpropyl)-3-propan-2-ylisoquinolin-1-one is CC(C)c1cc2cccc(Cl)c2c(=O)n1CC(C)(C)C.
What is the InChIKey of 8-chloro-2-(2,2-dimethylpropyl)-3-propan-2-ylisoquinolin-1-one?
The InChIKey is REWQPUJBRUUHRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22ClNO/c1-11(2)14-9-12-7-6-8-13(18)15(12)16(20)19(14)10-17(3,4)5/h6-9,11H,10H2,1-5H3.
What are the key properties of 8-chloro-2-(2,2-dimethylpropyl)-3-propan-2-ylisoquinolin-1-one?
8-chloro-2-(2,2-dimethylpropyl)-3-propan-2-ylisoquinolin-1-one has a molecular weight of 291.82 g/mol, XLogP of 4.82, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-2-(2,2-dimethylpropyl)-3-propan-2-ylisoquinolin-1-one is sourced from PubChem (CID 71291782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).