C17H17N3O4 — CID 71292091
6-(3-amino-1-methylindol-5-yl)-5-ethyl-4-hydroxy-2-oxo-1H-pyridine-3-carboxylic acid (PubChem CID 71292091) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is 6-(3-amino-1-methylindol-5-yl)-5-ethyl-4-hydroxy-2-oxo-1H-pyridine-3-carboxylic acid.
| Compound Name | 6-(3-amino-1-methylindol-5-yl)-5-ethyl-4-hydroxy-2-oxo-1H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 71292091 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 6-(3-amino-1-methylindol-5-yl)-5-ethyl-4-hydroxy-2-oxo-1H-pyridine-3-carboxylic acid |
| SMILES | CCc1c(-c2ccc3c(c2)c(N)cn3C)[nH]c(=O)c(C(=O)O)c1O |
| InChI | InChI=1S/C17H17N3O4/c1-3-9-14(19-16(22)13(15(9)21)17(23)24)8-4-5-12-10(6-8)11(18)7-20(12)2/h4-7H,3,18H2,1-2H3,(H,23,24)(H2,19,21,22) |
| InChIKey | YOWSVPYBIVDTAW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 121.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |