C12H12NO3- — CID 7129212
1-(furan-2-ylmethyl)-2,5-dimethylpyrrole-3-carboxylate (PubChem CID 7129212) has the molecular formula C12H12NO3- and a molecular weight of 218.23 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-2,5-dimethylpyrrole-3-carboxylate.
| Compound Name | 1-(furan-2-ylmethyl)-2,5-dimethylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 7129212 |
| Molecular Formula | C12H12NO3- |
| Molecular Weight | 218.23 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 1-(furan-2-ylmethyl)-2,5-dimethylpyrrole-3-carboxylate |
| SMILES | Cc1cc(C(=O)[O-])c(C)n1Cc1ccco1 |
| InChI | InChI=1S/C12H13NO3/c1-8-6-11(12(14)15)9(2)13(8)7-10-4-3-5-16-10/h3-6H,7H2,1-2H3,(H,14,15)/p-1 |
| InChIKey | IAEYHHRNDQVTRT-UHFFFAOYSA-M |
| XLogP | 1.11 |
| TPSA | 58.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.23 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |