C14H16NO2S- — CID 7129228
(3R)-3-(1,3-benzothiazol-2-ylmethyl)-3-methylpentanoate (PubChem CID 7129228) has the molecular formula C14H16NO2S- and a molecular weight of 262.35 g/mol. Its IUPAC name is (3R)-3-(1,3-benzothiazol-2-ylmethyl)-3-methylpentanoate.
| Compound Name | (3R)-3-(1,3-benzothiazol-2-ylmethyl)-3-methylpentanoate |
|---|---|
| PubChem CID | 7129228 |
| Molecular Formula | C14H16NO2S- |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | (3R)-3-(1,3-benzothiazol-2-ylmethyl)-3-methylpentanoate |
| SMILES | CC[C@](C)(CC(=O)[O-])Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C14H17NO2S/c1-3-14(2,9-13(16)17)8-12-15-10-6-4-5-7-11(10)18-12/h4-7H,3,8-9H2,1-2H3,(H,16,17)/p-1/t14-/m0/s1 |
| InChIKey | GIBIKRFPDXOAHN-AWEZNQCLSA-M |
| XLogP | 2.40 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |