About N-[6-(3,4-dichlorophenyl)pyrimidin-4-yl]benzenesulfonamide
N-[6-(3,4-dichlorophenyl)pyrimidin-4-yl]benzenesulfonamide (PubChem CID 71292547) has the molecular formula C16H11Cl2N3O2S
and a molecular weight of 380.26 g/mol. Its IUPAC name is N-[6-(3,4-dichlorophenyl)pyrimidin-4-yl]benzenesulfonamide.
Molecular Properties
| Compound Name | N-[6-(3,4-dichlorophenyl)pyrimidin-4-yl]benzenesulfonamide |
| PubChem CID | 71292547 |
| Molecular Formula | C16H11Cl2N3O2S |
| Molecular Weight | 380.26 g/mol |
| Exact Mass | 378.99 |
| IUPAC Name | N-[6-(3,4-dichlorophenyl)pyrimidin-4-yl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(-c2ccc(Cl)c(Cl)c2)ncn1)c1ccccc1 |
| InChI | InChI=1S/C16H11Cl2N3O2S/c17-13-7-6-11(8-14(13)18)15-9-16(20-10-19-15)21-24(22,23)12-4-2-1-3-5-12/h1-10H,(H,19,20,21) |
| InChIKey | AYEXGLOHSIPFQZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.26 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[6-(3,4-dichlorophenyl)pyrimidin-4-yl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(3,4-dichlorophenyl)pyrimidin-4-yl]benzenesulfonamide?
The IUPAC name of N-[6-(3,4-dichlorophenyl)pyrimidin-4-yl]benzenesulfonamide (CID 71292547) is N-[6-(3,4-dichlorophenyl)pyrimidin-4-yl]benzenesulfonamide.
What is the SMILES notation for N-[6-(3,4-dichlorophenyl)pyrimidin-4-yl]benzenesulfonamide?
The canonical SMILES for N-[6-(3,4-dichlorophenyl)pyrimidin-4-yl]benzenesulfonamide is O=S(=O)(Nc1cc(-c2ccc(Cl)c(Cl)c2)ncn1)c1ccccc1.
What is the InChIKey of N-[6-(3,4-dichlorophenyl)pyrimidin-4-yl]benzenesulfonamide?
The InChIKey is AYEXGLOHSIPFQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11Cl2N3O2S/c17-13-7-6-11(8-14(13)18)15-9-16(20-10-19-15)21-24(22,23)12-4-2-1-3-5-12/h1-10H,(H,19,20,21).
What are the key properties of N-[6-(3,4-dichlorophenyl)pyrimidin-4-yl]benzenesulfonamide?
N-[6-(3,4-dichlorophenyl)pyrimidin-4-yl]benzenesulfonamide has a molecular weight of 380.26 g/mol, XLogP of 4.25, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(3,4-dichlorophenyl)pyrimidin-4-yl]benzenesulfonamide is sourced from PubChem (CID 71292547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).