About N-[6-(3,4-dichlorophenyl)pyrimidin-4-yl]-2,2-dimethylpropanamide
N-[6-(3,4-dichlorophenyl)pyrimidin-4-yl]-2,2-dimethylpropanamide (PubChem CID 71292603) has the molecular formula C15H15Cl2N3O
and a molecular weight of 324.21 g/mol. Its IUPAC name is N-[6-(3,4-dichlorophenyl)pyrimidin-4-yl]-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-[6-(3,4-dichlorophenyl)pyrimidin-4-yl]-2,2-dimethylpropanamide |
| PubChem CID | 71292603 |
| Molecular Formula | C15H15Cl2N3O |
| Molecular Weight | 324.21 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | N-[6-(3,4-dichlorophenyl)pyrimidin-4-yl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1cc(-c2ccc(Cl)c(Cl)c2)ncn1 |
| InChI | InChI=1S/C15H15Cl2N3O/c1-15(2,3)14(21)20-13-7-12(18-8-19-13)9-4-5-10(16)11(17)6-9/h4-8H,1-3H3,(H,18,19,20,21) |
| InChIKey | AZGLNZIRLFGGIZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.21 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[6-(3,4-dichlorophenyl)pyrimidin-4-yl]-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(3,4-dichlorophenyl)pyrimidin-4-yl]-2,2-dimethylpropanamide?
The IUPAC name of N-[6-(3,4-dichlorophenyl)pyrimidin-4-yl]-2,2-dimethylpropanamide (CID 71292603) is N-[6-(3,4-dichlorophenyl)pyrimidin-4-yl]-2,2-dimethylpropanamide.
What is the SMILES notation for N-[6-(3,4-dichlorophenyl)pyrimidin-4-yl]-2,2-dimethylpropanamide?
The canonical SMILES for N-[6-(3,4-dichlorophenyl)pyrimidin-4-yl]-2,2-dimethylpropanamide is CC(C)(C)C(=O)Nc1cc(-c2ccc(Cl)c(Cl)c2)ncn1.
What is the InChIKey of N-[6-(3,4-dichlorophenyl)pyrimidin-4-yl]-2,2-dimethylpropanamide?
The InChIKey is AZGLNZIRLFGGIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15Cl2N3O/c1-15(2,3)14(21)20-13-7-12(18-8-19-13)9-4-5-10(16)11(17)6-9/h4-8H,1-3H3,(H,18,19,20,21).
What are the key properties of N-[6-(3,4-dichlorophenyl)pyrimidin-4-yl]-2,2-dimethylpropanamide?
N-[6-(3,4-dichlorophenyl)pyrimidin-4-yl]-2,2-dimethylpropanamide has a molecular weight of 324.21 g/mol, XLogP of 4.43, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(3,4-dichlorophenyl)pyrimidin-4-yl]-2,2-dimethylpropanamide is sourced from PubChem (CID 71292603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).