C18H28N2O3 — CID 71292632
3-(2,5-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-N,3-dimethyl-N-[3-(methylamino)propyl]butanamide (PubChem CID 71292632) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is 3-(2,5-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-N,3-dimethyl-N-[3-(methylamino)propyl]butanamide.
| Compound Name | 3-(2,5-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-N,3-dimethyl-N-[3-(methylamino)propyl]butanamide |
|---|---|
| PubChem CID | 71292632 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | 3-(2,5-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-N,3-dimethyl-N-[3-(methylamino)propyl]butanamide |
| SMILES | CNCCCN(C)C(=O)CC(C)(C)C1=C(C)C(=O)C=C(C)C1=O |
| InChI | InChI=1S/C18H28N2O3/c1-12-10-14(21)13(2)16(17(12)23)18(3,4)11-15(22)20(6)9-7-8-19-5/h10,19H,7-9,11H2,1-6H3 |
| InChIKey | FGGRMNVINRXZAO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|