C24H28N2O2S — CID 71292903
3-methyl-N-[[2-[(2-phenyl-3,4-dihydro-2H-chromen-6-yl)oxy]-1,3-thiazol-5-yl]methyl]butan-1-amine (PubChem CID 71292903) has the molecular formula C24H28N2O2S and a molecular weight of 408.57 g/mol. Its IUPAC name is 3-methyl-N-[[2-[(2-phenyl-3,4-dihydro-2H-chromen-6-yl)oxy]-1,3-thiazol-5-yl]methyl]butan-1-amine.
| Compound Name | 3-methyl-N-[[2-[(2-phenyl-3,4-dihydro-2H-chromen-6-yl)oxy]-1,3-thiazol-5-yl]methyl]butan-1-amine |
|---|---|
| PubChem CID | 71292903 |
| Molecular Formula | C24H28N2O2S |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 3-methyl-N-[[2-[(2-phenyl-3,4-dihydro-2H-chromen-6-yl)oxy]-1,3-thiazol-5-yl]methyl]butan-1-amine |
| SMILES | CC(C)CCNCc1cnc(Oc2ccc3c(c2)CCC(c2ccccc2)O3)s1 |
| InChI | InChI=1S/C24H28N2O2S/c1-17(2)12-13-25-15-21-16-26-24(29-21)27-20-9-11-23-19(14-20)8-10-22(28-23)18-6-4-3-5-7-18/h3-7,9,11,14,16-17,22,25H,8,10,12-13,15H2,1-2H3 |
| InChIKey | XZDRMWHWPNQRHE-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|