About 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)butanoate
4-(4-methyl-2-oxo-1,3-thiazol-3-yl)butanoate (PubChem CID 7129296) has the molecular formula C8H10NO3S-
and a molecular weight of 200.24 g/mol. Its IUPAC name is 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)butanoate.
Molecular Properties
| Compound Name | 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)butanoate |
| PubChem CID | 7129296 |
| Molecular Formula | C8H10NO3S- |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)butanoate |
| SMILES | Cc1csc(=O)n1CCCC(=O)[O-] |
| InChI | InChI=1S/C8H11NO3S/c1-6-5-13-8(12)9(6)4-2-3-7(10)11/h5H,2-4H2,1H3,(H,10,11)/p-1 |
| InChIKey | DYRYBHFPOZKIQX-UHFFFAOYSA-M |
| XLogP | -0.25 |
| TPSA | 62.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)butanoate?
The IUPAC name of 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)butanoate (CID 7129296) is 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)butanoate.
What is the SMILES notation for 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)butanoate?
The canonical SMILES for 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)butanoate is Cc1csc(=O)n1CCCC(=O)[O-].
What is the InChIKey of 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)butanoate?
The InChIKey is DYRYBHFPOZKIQX-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H11NO3S/c1-6-5-13-8(12)9(6)4-2-3-7(10)11/h5H,2-4H2,1H3,(H,10,11)/p-1.
What are the key properties of 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)butanoate?
4-(4-methyl-2-oxo-1,3-thiazol-3-yl)butanoate has a molecular weight of 200.24 g/mol, XLogP of -0.25, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)butanoate is sourced from PubChem (CID 7129296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).