C18H18ClF3N4O2 — CID 71293158
N-[3-(3-amino-6,6-difluoro-5-methyl-1,3-oxazepan-5-yl)-4-fluorophenyl]-3-chloropyridine-2-carboxamide (PubChem CID 71293158) has the molecular formula C18H18ClF3N4O2 and a molecular weight of 414.82 g/mol. Its IUPAC name is N-[3-(3-amino-6,6-difluoro-5-methyl-1,3-oxazepan-5-yl)-4-fluorophenyl]-3-chloropyridine-2-carboxamide.
| Compound Name | N-[3-(3-amino-6,6-difluoro-5-methyl-1,3-oxazepan-5-yl)-4-fluorophenyl]-3-chloropyridine-2-carboxamide |
|---|---|
| PubChem CID | 71293158 |
| Molecular Formula | C18H18ClF3N4O2 |
| Molecular Weight | 414.82 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | N-[3-(3-amino-6,6-difluoro-5-methyl-1,3-oxazepan-5-yl)-4-fluorophenyl]-3-chloropyridine-2-carboxamide |
| SMILES | CC1(c2cc(NC(=O)c3ncccc3Cl)ccc2F)CN(N)COCC1(F)F |
| InChI | InChI=1S/C18H18ClF3N4O2/c1-17(8-26(23)10-28-9-18(17,21)22)12-7-11(4-5-14(12)20)25-16(27)15-13(19)3-2-6-24-15/h2-7H,8-10,23H2,1H3,(H,25,27) |
| InChIKey | KSHHGQJKMXHCBO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.82 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|