C18H25FN6O2 — CID 71294040
2-[5-[4-(6-fluoro-2-pyridinyl)piperazin-1-yl]pentyl]-4-methyl-1,2,4-triazine-3,5-dione (PubChem CID 71294040) has the molecular formula C18H25FN6O2 and a molecular weight of 376.44 g/mol. Its IUPAC name is 2-[5-[4-(6-fluoro-2-pyridinyl)piperazin-1-yl]pentyl]-4-methyl-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[5-[4-(6-fluoro-2-pyridinyl)piperazin-1-yl]pentyl]-4-methyl-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 71294040 |
| Molecular Formula | C18H25FN6O2 |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 2-[5-[4-(6-fluoro-2-pyridinyl)piperazin-1-yl]pentyl]-4-methyl-1,2,4-triazine-3,5-dione |
| SMILES | Cn1c(=O)cnn(CCCCCN2CCN(c3cccc(F)n3)CC2)c1=O |
| InChI | InChI=1S/C18H25FN6O2/c1-22-17(26)14-20-25(18(22)27)9-4-2-3-8-23-10-12-24(13-11-23)16-7-5-6-15(19)21-16/h5-7,14H,2-4,8-13H2,1H3 |
| InChIKey | QOZOMUGMLYFGQD-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 76.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|