C11H11ClN2O — CID 7129414
2-[(1S)-1-chloroethyl]-5-(3-methylphenyl)-1,3,4-oxadiazole (PubChem CID 7129414) has the molecular formula C11H11ClN2O and a molecular weight of 222.68 g/mol. Its IUPAC name is 2-[(1S)-1-chloroethyl]-5-(3-methylphenyl)-1,3,4-oxadiazole.
| Compound Name | 2-[(1S)-1-chloroethyl]-5-(3-methylphenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 7129414 |
| Molecular Formula | C11H11ClN2O |
| Molecular Weight | 222.68 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 2-[(1S)-1-chloroethyl]-5-(3-methylphenyl)-1,3,4-oxadiazole |
| SMILES | Cc1cccc(-c2nnc([C@H](C)Cl)o2)c1 |
| InChI | InChI=1S/C11H11ClN2O/c1-7-4-3-5-9(6-7)11-14-13-10(15-11)8(2)12/h3-6,8H,1-2H3/t8-/m0/s1 |
| InChIKey | CRIYFDWVUKKTIA-QMMMGPOBSA-N |
| XLogP | 3.34 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.68 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|