C18H22N6O4 — CID 71294142
4-methyl-2-[4-[4-(6-nitro-2-pyridinyl)-3,6-dihydro-2H-pyridin-1-yl]butyl]-1,2,4-triazine-3,5-dione (PubChem CID 71294142) has the molecular formula C18H22N6O4 and a molecular weight of 386.41 g/mol. Its IUPAC name is 4-methyl-2-[4-[4-(6-nitro-2-pyridinyl)-3,6-dihydro-2H-pyridin-1-yl]butyl]-1,2,4-triazine-3,5-dione.
| Compound Name | 4-methyl-2-[4-[4-(6-nitro-2-pyridinyl)-3,6-dihydro-2H-pyridin-1-yl]butyl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 71294142 |
| Molecular Formula | C18H22N6O4 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 4-methyl-2-[4-[4-(6-nitro-2-pyridinyl)-3,6-dihydro-2H-pyridin-1-yl]butyl]-1,2,4-triazine-3,5-dione |
| SMILES | Cn1c(=O)cnn(CCCCN2CC=C(c3cccc([N+](=O)[O-])n3)CC2)c1=O |
| InChI | InChI=1S/C18H22N6O4/c1-21-17(25)13-19-23(18(21)26)10-3-2-9-22-11-7-14(8-12-22)15-5-4-6-16(20-15)24(27)28/h4-7,13H,2-3,8-12H2,1H3 |
| InChIKey | GDRAXZTYZAYALT-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 116.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|