C20H21F3N2O2 — CID 71294308
N-[5-cyclohexyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]benzamide (PubChem CID 71294308) has the molecular formula C20H21F3N2O2 and a molecular weight of 378.39 g/mol. Its IUPAC name is N-[5-cyclohexyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]benzamide.
| Compound Name | N-[5-cyclohexyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 71294308 |
| Molecular Formula | C20H21F3N2O2 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | N-[5-cyclohexyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]benzamide |
| SMILES | O=C(Nc1cnc(OCC(F)(F)F)c(C2CCCCC2)c1)c1ccccc1 |
| InChI | InChI=1S/C20H21F3N2O2/c21-20(22,23)13-27-19-17(14-7-3-1-4-8-14)11-16(12-24-19)25-18(26)15-9-5-2-6-10-15/h2,5-6,9-12,14H,1,3-4,7-8,13H2,(H,25,26) |
| InChIKey | FEIDIJXFDKYXPY-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |