About tert-butyl N-[(2S)-1-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyl]hydrazinyl]-1-oxobutan-2-yl]carbamate
tert-butyl N-[(2S)-1-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyl]hydrazinyl]-1-oxobutan-2-yl]carbamate (PubChem CID 71294466) has the molecular formula C19H30N4O6
and a molecular weight of 410.47 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyl]hydrazinyl]-1-oxobutan-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(2S)-1-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyl]hydrazinyl]-1-oxobutan-2-yl]carbamate |
| PubChem CID | 71294466 |
| Molecular Formula | C19H30N4O6 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | tert-butyl N-[(2S)-1-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyl]hydrazinyl]-1-oxobutan-2-yl]carbamate |
| SMILES | CC[C@H](NC(=O)OC(C)(C)C)C(=O)NNC(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C19H30N4O6/c1-5-13(20-18(28)29-19(2,3)4)17(27)22-21-14(24)9-7-6-8-12-23-15(25)10-11-16(23)26/h10-11,13H,5-9,12H2,1-4H3,(H,20,28)(H,21,24)(H,22,27)/t13-/m0/s1 |
| InChIKey | OPHNAFPJNMSHKY-ZDUSSCGKSA-N |
| XLogP | 0.92 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(2S)-1-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyl]hydrazinyl]-1-oxobutan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(2S)-1-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyl]hydrazinyl]-1-oxobutan-2-yl]carbamate?
The IUPAC name of tert-butyl N-[(2S)-1-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyl]hydrazinyl]-1-oxobutan-2-yl]carbamate (CID 71294466) is tert-butyl N-[(2S)-1-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyl]hydrazinyl]-1-oxobutan-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[(2S)-1-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyl]hydrazinyl]-1-oxobutan-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[(2S)-1-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyl]hydrazinyl]-1-oxobutan-2-yl]carbamate is CC[C@H](NC(=O)OC(C)(C)C)C(=O)NNC(=O)CCCCCN1C(=O)C=CC1=O.
What is the InChIKey of tert-butyl N-[(2S)-1-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyl]hydrazinyl]-1-oxobutan-2-yl]carbamate?
The InChIKey is OPHNAFPJNMSHKY-ZDUSSCGKSA-N. The full InChI is InChI=1S/C19H30N4O6/c1-5-13(20-18(28)29-19(2,3)4)17(27)22-21-14(24)9-7-6-8-12-23-15(25)10-11-16(23)26/h10-11,13H,5-9,12H2,1-4H3,(H,20,28)(H,21,24)(H,22,27)/t13-/m0/s1.
What are the key properties of tert-butyl N-[(2S)-1-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyl]hydrazinyl]-1-oxobutan-2-yl]carbamate?
tert-butyl N-[(2S)-1-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyl]hydrazinyl]-1-oxobutan-2-yl]carbamate has a molecular weight of 410.47 g/mol, XLogP of 0.92, 9 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(2S)-1-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyl]hydrazinyl]-1-oxobutan-2-yl]carbamate is sourced from PubChem (CID 71294466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).