About dibenzyl (2S)-4-(4-methylphenyl)sulfonylpyrrolidine-1,2-dicarboxylate
dibenzyl (2S)-4-(4-methylphenyl)sulfonylpyrrolidine-1,2-dicarboxylate (PubChem CID 71294604) has the molecular formula C27H27NO6S
and a molecular weight of 493.58 g/mol. Its IUPAC name is dibenzyl (2S)-4-(4-methylphenyl)sulfonylpyrrolidine-1,2-dicarboxylate.
Molecular Properties
| Compound Name | dibenzyl (2S)-4-(4-methylphenyl)sulfonylpyrrolidine-1,2-dicarboxylate |
| PubChem CID | 71294604 |
| Molecular Formula | C27H27NO6S |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | dibenzyl (2S)-4-(4-methylphenyl)sulfonylpyrrolidine-1,2-dicarboxylate |
| SMILES | Cc1ccc(S(=O)(=O)C2C[C@@H](C(=O)OCc3ccccc3)N(C(=O)OCc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C27H27NO6S/c1-20-12-14-23(15-13-20)35(31,32)24-16-25(26(29)33-18-21-8-4-2-5-9-21)28(17-24)27(30)34-19-22-10-6-3-7-11-22/h2-15,24-25H,16-19H2,1H3/t24?,25-/m0/s1 |
| InChIKey | QKYCJVQXPFXSJI-BBMPLOMVSA-N |
| XLogP | 4.29 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze dibenzyl (2S)-4-(4-methylphenyl)sulfonylpyrrolidine-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzyl (2S)-4-(4-methylphenyl)sulfonylpyrrolidine-1,2-dicarboxylate?
The IUPAC name of dibenzyl (2S)-4-(4-methylphenyl)sulfonylpyrrolidine-1,2-dicarboxylate (CID 71294604) is dibenzyl (2S)-4-(4-methylphenyl)sulfonylpyrrolidine-1,2-dicarboxylate.
What is the SMILES notation for dibenzyl (2S)-4-(4-methylphenyl)sulfonylpyrrolidine-1,2-dicarboxylate?
The canonical SMILES for dibenzyl (2S)-4-(4-methylphenyl)sulfonylpyrrolidine-1,2-dicarboxylate is Cc1ccc(S(=O)(=O)C2C[C@@H](C(=O)OCc3ccccc3)N(C(=O)OCc3ccccc3)C2)cc1.
What is the InChIKey of dibenzyl (2S)-4-(4-methylphenyl)sulfonylpyrrolidine-1,2-dicarboxylate?
The InChIKey is QKYCJVQXPFXSJI-BBMPLOMVSA-N. The full InChI is InChI=1S/C27H27NO6S/c1-20-12-14-23(15-13-20)35(31,32)24-16-25(26(29)33-18-21-8-4-2-5-9-21)28(17-24)27(30)34-19-22-10-6-3-7-11-22/h2-15,24-25H,16-19H2,1H3/t24?,25-/m0/s1.
What are the key properties of dibenzyl (2S)-4-(4-methylphenyl)sulfonylpyrrolidine-1,2-dicarboxylate?
dibenzyl (2S)-4-(4-methylphenyl)sulfonylpyrrolidine-1,2-dicarboxylate has a molecular weight of 493.58 g/mol, XLogP of 4.29, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzyl (2S)-4-(4-methylphenyl)sulfonylpyrrolidine-1,2-dicarboxylate is sourced from PubChem (CID 71294604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).